CAS 1359655-85-8 is the registry number for 2,5-Diazaspiro[3.4]octane-5-carboxylic acid tert-butyl ester oxalate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate;oxalic acid (CAS 1359655-85-8) is a chemical compound with the molecular formula C13H22N2O6 and a molecular weight of 302.32 g/mol. IUPAC name: tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate;oxalic acid. InChIKey: OYVDREJBJQMATQ-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O6 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate;oxalic acid |
| InChIKey | OYVDREJBJQMATQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)