CAS 1803607-90-0 appears in our catalog under these names: tert-Butyl (3-azabicyclo(3.1.1)heptan-6-yl)carbamate oxalate, 97+%, tert-Butyl N-{3-azabicyclo(3.1.1)heptan-6-yl}carbamate oxalate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-(3-azabicyclo[3.1.1]heptan-6-yl)carbamate;oxalic acid (CAS 1803607-90-0) is a chemical compound with the molecular formula C13H22N2O6 and a molecular weight of 302.32 g/mol. IUPAC name: tert-butyl N-(3-azabicyclo[3.1.1]heptan-6-yl)carbamate;oxalic acid. InChIKey: CTCNNIULUJYERS-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O6 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | tert-butyl N-(3-azabicyclo[3.1.1]heptan-6-yl)carbamate;oxalic acid |
| InChIKey | CTCNNIULUJYERS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C2CC1CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)