Products 2177263-40-8

CAS 2177263-40-8 is the registry number for 3,7-Diaza-bicyclo[4.2.0]octane-3-carboxylic acid tert-butyl ester oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate;oxalic acid (CAS 2177263-40-8) is a chemical compound with the molecular formula C13H22N2O6 and a molecular weight of 302.32 g/mol. IUPAC name: tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate;oxalic acid. InChIKey: XFBNDOMVZYCRRX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22N2O6
Molecular weight302.32 g/mol
IUPAC nametert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate;oxalic acid
InChIKeyXFBNDOMVZYCRRX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2C(C1)CN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)