Products 1359658-41-5

CAS 1359658-41-5 is the registry number for Fmoc-2-amino-5-(tritylthio)-pentanoic acid (R). Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid (CAS 1359658-41-5) is a chemical compound with the molecular formula C39H35NO4S and a molecular weight of 613.8 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid. InChIKey: POEDPRJPBCNZHB-PSXMRANNSA-N.

Identity
Molecular formulaC39H35NO4S
Molecular weight613.8 g/mol
IUPAC name(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid
InChIKeyPOEDPRJPBCNZHB-PSXMRANNSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCCC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46

Computed by PubChem (NCBI)