CAS 1417789-17-3 appears in our catalog under these names: (S)-Fmoc-2-amino-5-(tritylthio)-pentanoic acid, 95%, Fmoc-2-amino-5-(tritylthio)-pentanoic acid (S), Fmoc-HoHcy(Trt)-OH 96% (contains ~ 7.0% solvent), (S)-Fmoc-2-amino-5-(tritylthio)-pentanoic acid, 96%, 96%, (S)-FMOC-2-AMINO-5-(TRITYLTHIO)-PENTANOIC ACID, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid (CAS 1417789-17-3) is a chemical compound with the molecular formula C39H35NO4S and a molecular weight of 613.8 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid. InChIKey: POEDPRJPBCNZHB-BHVANESWSA-N.
| Molecular formula | C39H35NO4S |
|---|---|
| Molecular weight | 613.8 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-tritylsulfanylpentanoic acid |
| InChIKey | POEDPRJPBCNZHB-BHVANESWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)