CAS 526210-71-9 appears in our catalog under these names: Fmoc–N–Me–Homocys(Trt)–OH, Fmoc-N-Me-Homocys (Trt)-OH, Fmoc-L-N-Me-hCys(Trt)-OH 95%, (S)-2-(N-FMOC-N-METHYL-AMINO)-4-TRITYLSULFANYL-BUTYRIC ACID, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 500mg, 250mg, 1000mg, 2000mg, 5000mg, 100mg.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-tritylsulfanylbutanoic acid (CAS 526210-71-9) is a chemical compound with the molecular formula C39H35NO4S and a molecular weight of 613.8 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-tritylsulfanylbutanoic acid. InChIKey: XVDJDZSADBCCPL-BHVANESWSA-N.
| Molecular formula | C39H35NO4S |
|---|---|
| Molecular weight | 613.8 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-tritylsulfanylbutanoic acid |
| InChIKey | XVDJDZSADBCCPL-BHVANESWSA-N |
| SMILES | CN([C@@H](CCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O)C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)