CAS 201531-88-6 appears in our catalog under these names: Fmoc-S-trityl-L-penicillamine, 97%, Fmoc–Pen(Trt)–OH, Fmoc-L-Pen(Trt)-OH, Fmoc-S-trityl-L-penicillamine, Fmoc-Pen(Trt)-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g, 50g, 100mg, 250mg, 100g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid (CAS 201531-88-6) is a chemical compound with the molecular formula C39H35NO4S and a molecular weight of 613.8 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid. InChIKey: XSGMGAINOILNJR-PGUFJCEWSA-N.
| Molecular formula | C39H35NO4S |
|---|---|
| Molecular weight | 613.8 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid |
| InChIKey | XSGMGAINOILNJR-PGUFJCEWSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)