Products 1360651-24-6
CAS 1360651-24-6 appears in our catalog under these names: Fmoc-L-Photo-Leucine, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-methyl-3H-diazirin-3-yl)propanoic acid, 97%, 97%, Fmoc-L-photo-leucine, 99.72%, Fmoc-L-photo-leucine, 98%, Fmoc-Photo-Leu-OH, 97%. Offered by: Iris Biotech, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg, 10mg, 25mg, 10 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyldiazirin-3-yl)propanoic acid (CAS 1360651-24-6) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyldiazirin-3-yl)propanoic acid. InChIKey: GDWMJFRPAHGSDU-KRWDZBQOSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyldiazirin-3-yl)propanoic acid |
| InChIKey | GDWMJFRPAHGSDU-KRWDZBQOSA-N |
| SMILES | CC1(N=N1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-L-Photo-Leucine, Fmoc-Photo-Leu-OH