Products 2984765-48-0
CAS 2984765-48-0 appears in our catalog under these names: (S)–NIK SMI1, (S)-NIK SMI1, 99.28%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 10mM/1mL, 100 mg, 5 mg, 50 mg, 10 mg.
6-[3-[2-[(3S)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]-4-methoxypyridine-2-carboxamide (CAS 2984765-48-0) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: 6-[3-[2-[(3S)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]-4-methoxypyridine-2-carboxamide. InChIKey: LQSHXYHWYGKAMX-HXUWFJFHSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 6-[3-[2-[(3S)-3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl]ethynyl]phenyl]-4-methoxypyridine-2-carboxamide |
| InChIKey | LQSHXYHWYGKAMX-HXUWFJFHSA-N |
| SMILES | CN1CC[C@@](C1=O)(C#CC2=CC(=CC=C2)C3=NC(=CC(=C3)OC)C(=O)N)O |
Computed by PubChem (NCBI)
Synonyms:
NIK inhibitor 4f, orb3145398