Products 149054-56-8
CAS 149054-56-8 appears in our catalog under these names: (E)-Fenpyroximate (free acid), Fenpyroximate (free acid). Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1x10mg.
4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid (CAS 149054-56-8) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid. InChIKey: ZGSVZVKVXOZKSG-CIAFOILYSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid |
| InChIKey | ZGSVZVKVXOZKSG-CIAFOILYSA-N |
| SMILES | CC1=NN(C(=C1/C=N/OCC2=CC=C(C=C2)C(=O)O)OC3=CC=CC=C3)C |
Computed by PubChem (NCBI)
Synonyms:
(E)-Fenpyroximate (free acid), Fenpyroximate M-3