Products 854171-35-0
CAS 854171-35-0 appears in our catalog under these names: Indirubin Derivative E804, Indirubin Derivative E804, (2Z,3Z)-3-((3,4-Dihydroxybutoxy)imino)-[2,3'-biindolinylidene]-2'-one, ≥99%, ≥99%, Indirubin Derivative E804, 98.54%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 2mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 50 mg, 5 mg.
4-[(Z)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxybutane-1,2-diol (CAS 854171-35-0) is a chemical compound with the molecular formula C20H19N3O4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-[(Z)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxybutane-1,2-diol. InChIKey: TWOSIFOFWWXXIG-NKFKGCMQSA-N.
| Molecular formula | C20H19N3O4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-[(Z)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxybutane-1,2-diol |
| InChIKey | TWOSIFOFWWXXIG-NKFKGCMQSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)C\3=NC4=CC=CC=C4/C3=N/OCCC(CO)O |
Computed by PubChem (NCBI)