Products 136068-42-3
CAS 136068-42-3 appears in our catalog under these names: 2–(4–cinnamoylphenoxy)acetic acid, 2-(4-cinnamoylphenoxy)acetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]acetic acid (CAS 136068-42-3) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]acetic acid. InChIKey: QRZMBMJGILTZSR-IZZDOVSWSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-[4-[(E)-3-phenylprop-2-enoyl]phenoxy]acetic acid |
| InChIKey | QRZMBMJGILTZSR-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)