CAS 1360899-39-3 is the registry number for 7-Chloro-6-(trifluoromethyl)-1H-benzo(d)imidazole, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-5-(trifluoromethyl)-1H-benzimidazole (CAS 1360899-39-3) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 4-chloro-5-(trifluoromethyl)-1H-benzimidazole. InChIKey: SLINFRZBHYNDIF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 4-chloro-5-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | SLINFRZBHYNDIF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1C(F)(F)F)Cl)N=CN2 |
Computed by PubChem (NCBI)