Products 1360928-27-3
CAS 1360928-27-3 is the registry number for methyl 5-bromo-6-methyl-1H-indazole-3-carboxylate. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 5-bromo-6-methyl-1H-indazole-3-carboxylate (CAS 1360928-27-3) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: methyl 5-bromo-6-methyl-1H-indazole-3-carboxylate. InChIKey: MVSLWJXWXSPYKC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | methyl 5-bromo-6-methyl-1H-indazole-3-carboxylate |
| InChIKey | MVSLWJXWXSPYKC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C(=NN2)C(=O)OC |
Computed by PubChem (NCBI)