Products 1360931-06-1
CAS 1360931-06-1 is the registry number for 6-bromo-5-fluoro-1H-indole-3-carboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-5-fluoro-1H-indole-3-carboxylic acid (CAS 1360931-06-1) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: 6-bromo-5-fluoro-1H-indole-3-carboxylic acid. InChIKey: GRIKTBYKZBFYOM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | 6-bromo-5-fluoro-1H-indole-3-carboxylic acid |
| InChIKey | GRIKTBYKZBFYOM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)NC=C2C(=O)O |
Computed by PubChem (NCBI)