Products 1781582-42-0

CAS 1781582-42-0 is the registry number for 5-Bromo-6-fluoro-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-6-fluoro-1H-indole-2-carboxylic acid (CAS 1781582-42-0) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: 5-bromo-6-fluoro-1H-indole-2-carboxylic acid. InChIKey: XCPAAORUBSZRLP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrFNO2
Molecular weight258.04 g/mol
IUPAC name5-bromo-6-fluoro-1H-indole-2-carboxylic acid
InChIKeyXCPAAORUBSZRLP-UHFFFAOYSA-N
SMILESC1=C2C=C(NC2=CC(=C1Br)F)C(=O)O

Computed by PubChem (NCBI)