Products 1360941-36-1
CAS 1360941-36-1 appears in our catalog under these names: 5-Bromo-7-fluoro-1H-indole-3-carboxylic acid, 95%, 5-Bromo-7-fluoro-1H-indole-3-carboxylic acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-bromo-7-fluoro-1H-indole-3-carboxylic acid (CAS 1360941-36-1) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: 5-bromo-7-fluoro-1H-indole-3-carboxylic acid. InChIKey: FJJBPZDUWFGNOD-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1H-indole-3-carboxylic acid |
| InChIKey | FJJBPZDUWFGNOD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)C(=O)O)F)Br |
Computed by PubChem (NCBI)