Products 926208-98-2
CAS 926208-98-2 appears in our catalog under these names: 7-Bromo-4-fluoro-1H-indole-2-carboxylic acid, 7-Bromo-4-fluoro-1h-indole-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
7-bromo-4-fluoro-1H-indole-2-carboxylic acid (CAS 926208-98-2) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: 7-bromo-4-fluoro-1H-indole-2-carboxylic acid. InChIKey: HOSBAJJUPHKMGW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | 7-bromo-4-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | HOSBAJJUPHKMGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)