Products 1360931-90-3
CAS 1360931-90-3 appears in our catalog under these names: 7'-(Trifluoromethyl)spiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 7'-(Trifluoromethyl)spiro(cyclopropane-1,3'-indolin)-2'-one, 95%, 7'–(TRIFLUOROMETHYL)SPIRO(CYCLOPROPANE–1，3'–INDOLIN)–2'–ONE. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
7-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 1360931-90-3) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 7-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: WPKXNYINDCZGOU-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 7-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | WPKXNYINDCZGOU-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C(=CC=C3)C(F)(F)F)NC2=O |
Computed by PubChem (NCBI)