CAS 1701-19-5 appears in our catalog under these names: 8-Methyl-2-(trifluoromethyl)quinolin-4-ol, 98%, 4–Hydroxy–8–methyl–2–(trifluoromethyl)quinoline. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 100g.
8-methyl-2-(trifluoromethyl)-1H-quinolin-4-one (CAS 1701-19-5) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 8-methyl-2-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: HLPDICBGZTVELB-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 8-methyl-2-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | HLPDICBGZTVELB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)