CAS 140908-88-9 appears in our catalog under these names: 2-methyl-8-(trifluoromethyl)quinolin-4-ol, 95%, 2-Methyl-8-(trifluoromethyl)quinolin-4-ol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 50g, 1g, 25g, 5g, 100mg, 250mg.
2-methyl-8-(trifluoromethyl)-1H-quinolin-4-one (CAS 140908-88-9) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 2-methyl-8-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: OTMHQQLVOKHQTM-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 2-methyl-8-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | OTMHQQLVOKHQTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)