CAS 83419-48-1 appears in our catalog under these names: 6'-(Trifluoromethyl)-spiro[cyclopropane-1,3'-[3H]indole]-2'(1'H)-one, 97%, 6'–(TRIFLUOROMETHYL)SPIRO(CYCLOPROPANE–1,3'–INDOLIN)–2'–ONE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
6-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 83419-48-1) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: CSJYICAUMKEQRH-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | CSJYICAUMKEQRH-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=C(C=C3)C(F)(F)F)NC2=O |
Computed by PubChem (NCBI)