CAS 1805595-96-3 is the registry number for Methyl 4–bromo–2–cyano–6–fluorobenzoate. Offered by: GLPBio. Available pack sizes: 100mg.
Methyl 4-bromo-2-cyano-6-fluorobenzoate (CAS 1805595-96-3) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: methyl 4-bromo-2-cyano-6-fluorobenzoate. InChIKey: DSEXZHLXIAVOLJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | methyl 4-bromo-2-cyano-6-fluorobenzoate |
| InChIKey | DSEXZHLXIAVOLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)Br)C#N |
Computed by PubChem (NCBI)