Products 1360948-07-7
CAS 1360948-07-7 appears in our catalog under these names: 5-Fluoro-1H-1,3-benzodiazole-6-carboxylic acid, 5-Fluoro-1H-benzo[d]imidazole-6-carboxylic acid, 95%, 5-fluoro-1H-1,3-benzodiazole-6-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
6-fluoro-1H-benzimidazole-5-carboxylic acid (CAS 1360948-07-7) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 6-fluoro-1H-benzimidazole-5-carboxylic acid. InChIKey: CDIVDELLRTUYAB-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 6-fluoro-1H-benzimidazole-5-carboxylic acid |
| InChIKey | CDIVDELLRTUYAB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1N=CN2)F)C(=O)O |
Computed by PubChem (NCBI)