CAS 1360950-77-1 appears in our catalog under these names: 5-Methyl-1h-indole-4-carboxylic acid, 95%, 5-Methyl-1H-indole-4-carboxylic acid 95%, 5-Methyl-1H-indole-4-carboxylic acid, 98%, 98%, 5-METHYL-1H-INDOLE-4-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-methyl-1H-indole-4-carboxylic acid (CAS 1360950-77-1) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-methyl-1H-indole-4-carboxylic acid. InChIKey: RXUCBSBKXSNLIR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-methyl-1H-indole-4-carboxylic acid |
| InChIKey | RXUCBSBKXSNLIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC=C2)C(=O)O |
Computed by PubChem (NCBI)