Products 1360952-27-7

CAS 1360952-27-7 is the registry number for 7-Methoxy-5-nitro-1H-indole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

7-methoxy-5-nitro-1H-indole-3-carboxylic acid (CAS 1360952-27-7) is a chemical compound with the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. IUPAC name: 7-methoxy-5-nitro-1H-indole-3-carboxylic acid. InChIKey: IOZGBNQIQNLVMY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O5
Molecular weight236.18 g/mol
IUPAC name7-methoxy-5-nitro-1H-indole-3-carboxylic acid
InChIKeyIOZGBNQIQNLVMY-UHFFFAOYSA-N
SMILESCOC1=CC(=CC2=C1NC=C2C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)