CAS 1597410-38-2 is the registry number for (E)-4-(2,4-Dinitrophenyl)-but-3-en-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
(E)-4-(2,4-dinitrophenyl)but-3-en-2-one (CAS 1597410-38-2) is a chemical compound with the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. IUPAC name: (E)-4-(2,4-dinitrophenyl)but-3-en-2-one. InChIKey: IJVHJKPKSAICOE-NSCUHMNNSA-N.
| Molecular formula | C10H8N2O5 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | (E)-4-(2,4-dinitrophenyl)but-3-en-2-one |
| InChIKey | IJVHJKPKSAICOE-NSCUHMNNSA-N |
| SMILES | CC(=O)/C=C/C1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)