CAS 443907-70-8 is the registry number for 3-(3-Nitrophenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 443907-70-8) is a chemical compound with the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. IUPAC name: 3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: IROSEBFOFFTHIM-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O5 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | IROSEBFOFFTHIM-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)