CAS 15209-14-0 is the registry number for Bis-maleimidomethyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione (CAS 15209-14-0) is a chemical compound with the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. IUPAC name: 1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione. InChIKey: UTRLJOWPWILGSB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O5 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione |
| InChIKey | UTRLJOWPWILGSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)COCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)