Products 1360952-91-5

CAS 1360952-91-5 is the registry number for Methyl 5,6-difluoro-1H-indole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5,6-difluoro-1H-indole-3-carboxylate (CAS 1360952-91-5) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: methyl 5,6-difluoro-1H-indole-3-carboxylate. InChIKey: NDHNEVGIZXYMHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F2NO2
Molecular weight211.16 g/mol
IUPAC namemethyl 5,6-difluoro-1H-indole-3-carboxylate
InChIKeyNDHNEVGIZXYMHJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CNC2=CC(=C(C=C21)F)F

Computed by PubChem (NCBI)