CAS 1360952-91-5 is the registry number for Methyl 5,6-difluoro-1H-indole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,6-difluoro-1H-indole-3-carboxylate (CAS 1360952-91-5) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: methyl 5,6-difluoro-1H-indole-3-carboxylate. InChIKey: NDHNEVGIZXYMHJ-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO2 |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | methyl 5,6-difluoro-1H-indole-3-carboxylate |
| InChIKey | NDHNEVGIZXYMHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=CC(=C(C=C21)F)F |
Computed by PubChem (NCBI)