CAS 2167142-20-1 is the registry number for 4-(Difluoromethyl)-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)-1H-indole-2-carboxylic acid (CAS 2167142-20-1) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: 4-(difluoromethyl)-1H-indole-2-carboxylic acid. InChIKey: HHCHVCRDRZAOBB-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO2 |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 4-(difluoromethyl)-1H-indole-2-carboxylic acid |
| InChIKey | HHCHVCRDRZAOBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(NC2=C1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)