Products 2167142-20-1

CAS 2167142-20-1 is the registry number for 4-(Difluoromethyl)-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(difluoromethyl)-1H-indole-2-carboxylic acid (CAS 2167142-20-1) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: 4-(difluoromethyl)-1H-indole-2-carboxylic acid. InChIKey: HHCHVCRDRZAOBB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F2NO2
Molecular weight211.16 g/mol
IUPAC name4-(difluoromethyl)-1H-indole-2-carboxylic acid
InChIKeyHHCHVCRDRZAOBB-UHFFFAOYSA-N
SMILESC1=CC(=C2C=C(NC2=C1)C(=O)O)C(F)F

Computed by PubChem (NCBI)