CAS 1785399-14-5 appears in our catalog under these names: 5,7-Difluoro-3-methyl-1H-indole-2-carboxylic acid, 95%, 5,7-Difluoro-3-methyl-1H-indole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,7-difluoro-3-methyl-1H-indole-2-carboxylic acid (CAS 1785399-14-5) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: 5,7-difluoro-3-methyl-1H-indole-2-carboxylic acid. InChIKey: RUTGKPKMHWIMFA-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO2 |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 5,7-difluoro-3-methyl-1H-indole-2-carboxylic acid |
| InChIKey | RUTGKPKMHWIMFA-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=C(C=C2F)F)C(=O)O |
Computed by PubChem (NCBI)