Products 1374358-07-2

CAS 1374358-07-2 is the registry number for Methyl 2-(4-cyano-2,5-difluorophenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(4-cyano-2,5-difluorophenyl)acetate (CAS 1374358-07-2) is a chemical compound with the molecular formula C10H7F2NO2 and a molecular weight of 211.16 g/mol. IUPAC name: methyl 2-(4-cyano-2,5-difluorophenyl)acetate. InChIKey: XSKIEEKZDPELGD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F2NO2
Molecular weight211.16 g/mol
IUPAC namemethyl 2-(4-cyano-2,5-difluorophenyl)acetate
InChIKeyXSKIEEKZDPELGD-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=C(C=C1F)C#N)F

Computed by PubChem (NCBI)