Products 1361311-46-7
CAS 1361311-46-7 is the registry number for 2-Amino-3-(trifluoromethyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-3-(trifluoromethyl)benzamide (CAS 1361311-46-7) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: 2-amino-3-(trifluoromethyl)benzamide. InChIKey: TXLDKGNFMJUVSB-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-amino-3-(trifluoromethyl)benzamide |
| InChIKey | TXLDKGNFMJUVSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)N)C(=O)N |
Computed by PubChem (NCBI)