CAS 136207-41-5 appears in our catalog under these names: (2R,3S)-5-(phenylimino)pentane-1,2,3-triol, (2R,3S)-5-(Phenylimino)pentane-1,2,3-triol, 95%, 1,2-Dideoxy-1-(phenylimino)-D-erythro-pentitol, 2-Deoxy-N-phenylglucosylamine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 2kg, 1kg, 5kg, 10kg.
(2R,3S)-5-phenyliminopentane-1,2,3-triol (CAS 136207-41-5) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2R,3S)-5-phenyliminopentane-1,2,3-triol. InChIKey: QXLHVPIMOYSNQR-WDEREUQCSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2R,3S)-5-phenyliminopentane-1,2,3-triol |
| InChIKey | QXLHVPIMOYSNQR-WDEREUQCSA-N |
| SMILES | C1=CC=C(C=C1)N=CC[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)