CAS 1363380-74-8 is the registry number for Ethyl 3-chloro-5-nitropyridine-4-acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 2-(3-chloro-5-nitro-4-pyridinyl)acetate (CAS 1363380-74-8) is a chemical compound with the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. IUPAC name: ethyl 2-(3-chloro-5-nitro-4-pyridinyl)acetate. InChIKey: KOUWHUCYTQFGGQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O4 |
|---|---|
| Molecular weight | 244.63 g/mol |
| IUPAC name | ethyl 2-(3-chloro-5-nitro-4-pyridinyl)acetate |
| InChIKey | KOUWHUCYTQFGGQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=NC=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)