CAS 522601-84-9 is the registry number for 2-Chloro-n-(2-hydroxyethyl)-4-nitrobenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2-hydroxyethyl)-4-nitrobenzamide (CAS 522601-84-9) is a chemical compound with the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. IUPAC name: 2-chloro-N-(2-hydroxyethyl)-4-nitrobenzamide. InChIKey: YICVOSAYOTXRNP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O4 |
|---|---|
| Molecular weight | 244.63 g/mol |
| IUPAC name | 2-chloro-N-(2-hydroxyethyl)-4-nitrobenzamide |
| InChIKey | YICVOSAYOTXRNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)C(=O)NCCO |
Computed by PubChem (NCBI)