Products 1609403-15-7
CAS 1609403-15-7 is the registry number for 3-(4-Chlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde dihydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde;dihydrate (CAS 1609403-15-7) is a chemical compound with the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde;dihydrate. InChIKey: XNNFSZSNAGKIEL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O4 |
|---|---|
| Molecular weight | 244.63 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde;dihydrate |
| InChIKey | XNNFSZSNAGKIEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C=O)Cl.O.O |
Computed by PubChem (NCBI)