Products 3223-77-6
CAS 3223-77-6 appears in our catalog under these names: 2-Chloro-n-(4-methoxy-2-nitro-phenyl)-acetamide, 95%, 2-Chloro-N-(4-methoxy-2-nitro-phenyl)-acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
2-chloro-N-(4-methoxy-2-nitrophenyl)acetamide (CAS 3223-77-6) is a chemical compound with the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. IUPAC name: 2-chloro-N-(4-methoxy-2-nitrophenyl)acetamide. InChIKey: VXMOZGZTQMIRJA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O4 |
|---|---|
| Molecular weight | 244.63 g/mol |
| IUPAC name | 2-chloro-N-(4-methoxy-2-nitrophenyl)acetamide |
| InChIKey | VXMOZGZTQMIRJA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)