Products 1363383-09-8
CAS 1363383-09-8 appears in our catalog under these names: 7-Bromopyrazolo[1,5-a]pyridine-2-carboxylic acid, 95%, 7-Bromopyrazolo(1,5-a)pyridine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 100mg, 5g, 1g.
7-bromopyrazolo[1,5-a]pyridine-2-carboxylic acid (CAS 1363383-09-8) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromopyrazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: QZLGYHSVPBZFIP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromopyrazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | QZLGYHSVPBZFIP-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NN2C(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)