CAS 1363407-28-6 is the registry number for Ethyl (Z)-3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)acrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (Z)-3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate (CAS 1363407-28-6) is a chemical compound with the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. IUPAC name: ethyl (Z)-3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate. InChIKey: SDERJCOTKYHVKX-CLFYSBASSA-N.
| Molecular formula | C15H16F3NO4 |
|---|---|
| Molecular weight | 331.29 g/mol |
| IUPAC name | ethyl (Z)-3-(dimethylamino)-2-(2,4,5-trifluoro-3-methoxybenzoyl)prop-2-enoate |
| InChIKey | SDERJCOTKYHVKX-CLFYSBASSA-N |
| SMILES | CCOC(=O)/C(=C\N(C)C)/C(=O)C1=CC(=C(C(=C1F)OC)F)F |
Computed by PubChem (NCBI)