CAS 1951444-39-5 is the registry number for Cis-1-((benzyloxy)carbonyl)-3-(trifluoromethyl)piperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(2S,3R)-1-phenylmethoxycarbonyl-3-(trifluoromethyl)piperidine-2-carboxylic acid (CAS 1951444-39-5) is a chemical compound with the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. IUPAC name: (2S,3R)-1-phenylmethoxycarbonyl-3-(trifluoromethyl)piperidine-2-carboxylic acid. InChIKey: NGJWSVHXSWUMJW-NEPJUHHUSA-N.
| Molecular formula | C15H16F3NO4 |
|---|---|
| Molecular weight | 331.29 g/mol |
| IUPAC name | (2S,3R)-1-phenylmethoxycarbonyl-3-(trifluoromethyl)piperidine-2-carboxylic acid |
| InChIKey | NGJWSVHXSWUMJW-NEPJUHHUSA-N |
| SMILES | C1C[C@H]([C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)