Products 2639371-40-5
CAS 2639371-40-5 is the registry number for rac-(2R,4S)-1-[(benzyloxy)carbonyl]-2-(trifluoromethyl)piperidine-4-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,4R)-1-phenylmethoxycarbonyl-2-(trifluoromethyl)piperidine-4-carboxylic acid (CAS 2639371-40-5) is a chemical compound with the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. IUPAC name: (2S,4R)-1-phenylmethoxycarbonyl-2-(trifluoromethyl)piperidine-4-carboxylic acid. InChIKey: DUXFVAGKGYPHMF-NEPJUHHUSA-N.
| Molecular formula | C15H16F3NO4 |
|---|---|
| Molecular weight | 331.29 g/mol |
| IUPAC name | (2S,4R)-1-phenylmethoxycarbonyl-2-(trifluoromethyl)piperidine-4-carboxylic acid |
| InChIKey | DUXFVAGKGYPHMF-NEPJUHHUSA-N |
| SMILES | C1CN([C@@H](C[C@@H]1C(=O)O)C(F)(F)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)