Products 49713-39-5

CAS 49713-39-5 is the registry number for Diethyl 2-([4-(trifluoromethyl)anilino]methylene)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate (CAS 49713-39-5) is a chemical compound with the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. IUPAC name: diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate. InChIKey: JJXDEKZGHIXHPA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16F3NO4
Molecular weight331.29 g/mol
IUPAC namediethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate
InChIKeyJJXDEKZGHIXHPA-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CNC1=CC=C(C=C1)C(F)(F)F)C(=O)OCC

Computed by PubChem (NCBI)