CAS 136451-58-6 is the registry number for BMY 42393. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid (CAS 136451-58-6) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid. InChIKey: AZZHJQQOAHWBPN-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid |
| InChIKey | AZZHJQQOAHWBPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)CCC3=CC(=CC=C3)OCC(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)