Products 136499-29-1
CAS 136499-29-1 is the registry number for RGH 5702. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(2-nitrophenyl)methyl]-1,3-thiazolidin-2-one (CAS 136499-29-1) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: 3-[(2-nitrophenyl)methyl]-1,3-thiazolidin-2-one. InChIKey: REJNNJJROLKACD-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 3-[(2-nitrophenyl)methyl]-1,3-thiazolidin-2-one |
| InChIKey | REJNNJJROLKACD-UHFFFAOYSA-N |
| SMILES | C1CSC(=O)N1CC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)