CAS 1365271-72-2 is the registry number for 5-Bromo-1-ethyl-6-fluoro-1,2,3-benzotriazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
5-bromo-1-ethyl-6-fluorobenzotriazole (CAS 1365271-72-2) is a chemical compound with the molecular formula C8H7BrFN3 and a molecular weight of 244.06 g/mol. IUPAC name: 5-bromo-1-ethyl-6-fluorobenzotriazole. InChIKey: GUHUOBOWMKHRIR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFN3 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 5-bromo-1-ethyl-6-fluorobenzotriazole |
| InChIKey | GUHUOBOWMKHRIR-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC(=C(C=C2N=N1)Br)F |
Computed by PubChem (NCBI)