CAS 1414029-30-3 appears in our catalog under these names: 5-Bromo-6-fluoro-1-methylindazol-3-amine, 98%, 5-Bromo-6-fluoro-1-methylindazol-3-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-bromo-6-fluoro-1-methylindazol-3-amine (CAS 1414029-30-3) is a chemical compound with the molecular formula C8H7BrFN3 and a molecular weight of 244.06 g/mol. IUPAC name: 5-bromo-6-fluoro-1-methylindazol-3-amine. InChIKey: LMWGTTNLFDIWPV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFN3 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1-methylindazol-3-amine |
| InChIKey | LMWGTTNLFDIWPV-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2C(=N1)N)Br)F |
Computed by PubChem (NCBI)