Products 2416917-59-2
CAS 2416917-59-2 is the registry number for 6-Bromo-3-ethyl-4-fluoro-3H-imidazo[4,5-c]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3-ethyl-4-fluoroimidazo[4,5-c]pyridine (CAS 2416917-59-2) is a chemical compound with the molecular formula C8H7BrFN3 and a molecular weight of 244.06 g/mol. IUPAC name: 6-bromo-3-ethyl-4-fluoroimidazo[4,5-c]pyridine. InChIKey: GCTMOLSWAYUUMA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFN3 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 6-bromo-3-ethyl-4-fluoroimidazo[4,5-c]pyridine |
| InChIKey | GCTMOLSWAYUUMA-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=CC(=NC(=C21)F)Br |
Computed by PubChem (NCBI)