Products 2940957-00-4
CAS 2940957-00-4 is the registry number for 5-bromo-7-fluoro-1,6-dimethyl-benzotriazole, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
5-bromo-7-fluoro-1,6-dimethylbenzotriazole (CAS 2940957-00-4) is a chemical compound with the molecular formula C8H7BrFN3 and a molecular weight of 244.06 g/mol. IUPAC name: 5-bromo-7-fluoro-1,6-dimethylbenzotriazole. InChIKey: FDPVPNGUEWQCRS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFN3 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1,6-dimethylbenzotriazole |
| InChIKey | FDPVPNGUEWQCRS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1F)N(N=N2)C)Br |
Computed by PubChem (NCBI)